C45H47N3 — CID 166943257
N-[4-(9-phenyl-1,2-dihydrocarbazol-3-yl)phenyl]-N-(7,9,9-trimethyl-1,4,4a,5,6,7,8,9a-octahydrofluoren-2-yl)-1,2-dihydropyridin-6-amine (PubChem CID 166943257) has the molecular formula C45H47N3 and a molecular weight of 629.89 g/mol. Its IUPAC name is N-[4-(9-phenyl-1,2-dihydrocarbazol-3-yl)phenyl]-N-(7,9,9-trimethyl-1,4,4a,5,6,7,8,9a-octahydrofluoren-2-yl)-1,2-dihydropyridin-6-amine.
| Compound Name | N-[4-(9-phenyl-1,2-dihydrocarbazol-3-yl)phenyl]-N-(7,9,9-trimethyl-1,4,4a,5,6,7,8,9a-octahydrofluoren-2-yl)-1,2-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 166943257 |
| Molecular Formula | C45H47N3 |
| Molecular Weight | 629.89 g/mol |
| Exact Mass | 629.38 |
| IUPAC Name | N-[4-(9-phenyl-1,2-dihydrocarbazol-3-yl)phenyl]-N-(7,9,9-trimethyl-1,4,4a,5,6,7,8,9a-octahydrofluoren-2-yl)-1,2-dihydropyridin-6-amine |
| SMILES | CC1CCC2=C(C1)C(C)(C)C1CC(N(C3=CC=CCN3)c3ccc(C4=Cc5c(n(-c6ccccc6)c6ccccc56)CC4)cc3)=CCC21 |
| InChI | InChI=1S/C45H47N3/c1-30-16-23-36-37-24-22-35(29-41(37)45(2,3)40(36)27-30)47(44-15-9-10-26-46-44)34-20-17-31(18-21-34)32-19-25-43-39(28-32)38-13-7-8-14-42(38)48(43)33-11-5-4-6-12-33/h4-15,17-18,20-22,28,30,37,41,46H,16,19,23-27,29H2,1-3H3 |
| InChIKey | AJDBAWGTIOAFKC-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.89 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|