About N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline
N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline (PubChem CID 166943361) has the molecular formula C21H27N
and a molecular weight of 293.45 g/mol. Its IUPAC name is N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline.
Molecular Properties
| Compound Name | N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline |
| PubChem CID | 166943361 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline |
| SMILES | CC1C=C(N(c2ccccc2)C2C=CC=CC2C)C(C)CC1 |
| InChI | InChI=1S/C21H27N/c1-16-13-14-18(3)21(15-16)22(19-10-5-4-6-11-19)20-12-8-7-9-17(20)2/h4-12,15-18,20H,13-14H2,1-3H3 |
| InChIKey | GPTRXIPRGPHDER-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline?
The IUPAC name of N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline (CID 166943361) is N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline.
What is the SMILES notation for N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline?
The canonical SMILES for N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline is CC1C=C(N(c2ccccc2)C2C=CC=CC2C)C(C)CC1.
What is the InChIKey of N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline?
The InChIKey is GPTRXIPRGPHDER-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N/c1-16-13-14-18(3)21(15-16)22(19-10-5-4-6-11-19)20-12-8-7-9-17(20)2/h4-12,15-18,20H,13-14H2,1-3H3.
What are the key properties of N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline?
N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline has a molecular weight of 293.45 g/mol, XLogP of 5.57, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,6-dimethylcyclohexen-1-yl)-N-(6-methylcyclohexa-2,4-dien-1-yl)aniline is sourced from PubChem (CID 166943361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).