About 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one
6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one (PubChem CID 166943791) has the molecular formula C24H46O2
and a molecular weight of 366.63 g/mol. Its IUPAC name is 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one.
Molecular Properties
| Compound Name | 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one |
| PubChem CID | 166943791 |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.35 |
| IUPAC Name | 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one |
| SMILES | C=C(CCC(CC(=O)C(CC)CC)OCC(C)C(C)CC)C(CC)CC |
| InChI | InChI=1S/C24H46O2/c1-9-18(6)20(8)17-26-23(16-24(25)22(12-4)13-5)15-14-19(7)21(10-2)11-3/h18,20-23H,7,9-17H2,1-6,8H3 |
| InChIKey | LSWOJROMTVRDKP-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one?
The IUPAC name of 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one (CID 166943791) is 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one.
What is the SMILES notation for 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one?
The canonical SMILES for 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one is C=C(CCC(CC(=O)C(CC)CC)OCC(C)C(C)CC)C(CC)CC.
What is the InChIKey of 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one?
The InChIKey is LSWOJROMTVRDKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O2/c1-9-18(6)20(8)17-26-23(16-24(25)22(12-4)13-5)15-14-19(7)21(10-2)11-3/h18,20-23H,7,9-17H2,1-6,8H3.
What are the key properties of 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one?
6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one has a molecular weight of 366.63 g/mol, XLogP of 7.22, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dimethylpentoxy)-3,10-diethyl-9-methylidenedodecan-4-one is sourced from PubChem (CID 166943791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).