C18H19F2N4O5PS — CID 166943803
[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfanylamino]methylphosphonic acid (PubChem CID 166943803) has the molecular formula C18H19F2N4O5PS and a molecular weight of 472.41 g/mol. Its IUPAC name is [[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfanylamino]methylphosphonic acid.
| Compound Name | [[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfanylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 166943803 |
| Molecular Formula | C18H19F2N4O5PS |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | [[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfanylamino]methylphosphonic acid |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(SNCP(=O)(O)O)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C18H19F2N4O5PS/c1-10(17(25)24-18(21)22)6-11-7-14(19)16(15(20)8-11)29-12-2-4-13(5-3-12)31-23-9-30(26,27)28/h2-8,23H,9H2,1H3,(H2,26,27,28)(H4,21,22,24,25)/b10-6+ |
| InChIKey | MISIQMKKTNFMHC-UXBLZVDNSA-N |
| XLogP | 2.69 |
| TPSA | 160.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|