C9H15N3 — CID 166943838
(8aS)-5-methyl-1,4,4a,5,8,8a-hexahydroquinazolin-2-amine (PubChem CID 166943838) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is (8aS)-5-methyl-1,4,4a,5,8,8a-hexahydroquinazolin-2-amine.
| Compound Name | (8aS)-5-methyl-1,4,4a,5,8,8a-hexahydroquinazolin-2-amine |
|---|---|
| PubChem CID | 166943838 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (8aS)-5-methyl-1,4,4a,5,8,8a-hexahydroquinazolin-2-amine |
| SMILES | CC1C=CC[C@@H]2NC(N)=NCC12 |
| InChI | InChI=1S/C9H15N3/c1-6-3-2-4-8-7(6)5-11-9(10)12-8/h2-3,6-8H,4-5H2,1H3,(H3,10,11,12)/t6?,7?,8-/m0/s1 |
| InChIKey | INHBKTYJCKRBDF-RRQHEKLDSA-N |
| XLogP | 0.49 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|