C11H18FNO — CID 166943959
(3Z,5E)-6-fluoro-N-methyl-4-propan-2-yloxyhepta-1,3,5-trien-3-amine (PubChem CID 166943959) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is (3Z,5E)-6-fluoro-N-methyl-4-propan-2-yloxyhepta-1,3,5-trien-3-amine.
| Compound Name | (3Z,5E)-6-fluoro-N-methyl-4-propan-2-yloxyhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 166943959 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (3Z,5E)-6-fluoro-N-methyl-4-propan-2-yloxyhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(NC)=C(\C=C(/C)F)OC(C)C |
| InChI | InChI=1S/C11H18FNO/c1-6-10(13-5)11(7-9(4)12)14-8(2)3/h6-8,13H,1H2,2-5H3/b9-7+,11-10- |
| InChIKey | WSYSFHYERAXNJW-GLYMIEGHSA-N |
| XLogP | 2.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|