About (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane
(4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane (PubChem CID 166943978) has the molecular formula C11H21FO2
and a molecular weight of 204.28 g/mol. Its IUPAC name is (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane.
Molecular Properties
| Compound Name | (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane |
| PubChem CID | 166943978 |
| Molecular Formula | C11H21FO2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane |
| SMILES | CCC1CC(OC)[C@H](OC)C(F)C1C |
| InChI | InChI=1S/C11H21FO2/c1-5-8-6-9(13-3)11(14-4)10(12)7(8)2/h7-11H,5-6H2,1-4H3/t7?,8?,9?,10?,11-/m0/s1 |
| InChIKey | OVPLPZPPAZXRLQ-FIJQTJJSSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane?
The IUPAC name of (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane (CID 166943978) is (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane.
What is the SMILES notation for (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane?
The canonical SMILES for (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane is CCC1CC(OC)[C@H](OC)C(F)C1C.
What is the InChIKey of (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane?
The InChIKey is OVPLPZPPAZXRLQ-FIJQTJJSSA-N. The full InChI is InChI=1S/C11H21FO2/c1-5-8-6-9(13-3)11(14-4)10(12)7(8)2/h7-11H,5-6H2,1-4H3/t7?,8?,9?,10?,11-/m0/s1.
What are the key properties of (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane?
(4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane has a molecular weight of 204.28 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-ethyl-3-fluoro-4,5-dimethoxy-2-methylcyclohexane is sourced from PubChem (CID 166943978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).