C8H15BrN2O2 — CID 166944123
1-[[(bromoamino)-methylamino]methyl]cyclopentane-1-carboxylic acid (PubChem CID 166944123) has the molecular formula C8H15BrN2O2 and a molecular weight of 251.12 g/mol. Its IUPAC name is 1-[[(bromoamino)-methylamino]methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[(bromoamino)-methylamino]methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 166944123 |
| Molecular Formula | C8H15BrN2O2 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 1-[[(bromoamino)-methylamino]methyl]cyclopentane-1-carboxylic acid |
| SMILES | CN(CC1(C(=O)O)CCCC1)NBr |
| InChI | InChI=1S/C8H15BrN2O2/c1-11(10-9)6-8(7(12)13)4-2-3-5-8/h10H,2-6H2,1H3,(H,12,13) |
| InChIKey | SVXWTGHIDIKGGA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|