C8H10FNO — CID 166944297
7-fluoro-3,4,4a,8a-tetrahydro-2H-1,4-benzoxazine (PubChem CID 166944297) has the molecular formula C8H10FNO and a molecular weight of 155.17 g/mol. Its IUPAC name is 7-fluoro-3,4,4a,8a-tetrahydro-2H-1,4-benzoxazine.
| Compound Name | 7-fluoro-3,4,4a,8a-tetrahydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 166944297 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 7-fluoro-3,4,4a,8a-tetrahydro-2H-1,4-benzoxazine |
| SMILES | FC1=CC2OCCNC2C=C1 |
| InChI | InChI=1S/C8H10FNO/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5,7-8,10H,3-4H2 |
| InChIKey | WJEMPPRFEIMBMG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |