About 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole
3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole (PubChem CID 166944307) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole |
| PubChem CID | 166944307 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole |
| SMILES | CC(C)(CC1CNc2ccccc21)N=O |
| InChI | InChI=1S/C12H16N2O/c1-12(2,14-15)7-9-8-13-11-6-4-3-5-10(9)11/h3-6,9,13H,7-8H2,1-2H3 |
| InChIKey | MQFHRVSPVGLYNP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole?
The IUPAC name of 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole (CID 166944307) is 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole.
What is the SMILES notation for 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole?
The canonical SMILES for 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole is CC(C)(CC1CNc2ccccc21)N=O.
What is the InChIKey of 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole?
The InChIKey is MQFHRVSPVGLYNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-12(2,14-15)7-9-8-13-11-6-4-3-5-10(9)11/h3-6,9,13H,7-8H2,1-2H3.
What are the key properties of 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole?
3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole has a molecular weight of 204.27 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-2-nitrosopropyl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 166944307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).