C16H28N4 — CID 166944334
N'-[3-[(3E)-4-(ethylideneamino)-2-methylpenta-1,3-dien-3-yl]iminobut-1-en-2-yl]-N-methylpropane-1,3-diamine (PubChem CID 166944334) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is N'-[3-[(3E)-4-(ethylideneamino)-2-methylpenta-1,3-dien-3-yl]iminobut-1-en-2-yl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[3-[(3E)-4-(ethylideneamino)-2-methylpenta-1,3-dien-3-yl]iminobut-1-en-2-yl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 166944334 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | N'-[3-[(3E)-4-(ethylideneamino)-2-methylpenta-1,3-dien-3-yl]iminobut-1-en-2-yl]-N-methylpropane-1,3-diamine |
| SMILES | C=C(NCCCNC)/C(C)=N\C(C(=C)C)=C(C)\N=C\C |
| InChI | InChI=1S/C16H28N4/c1-8-18-15(6)16(12(2)3)20-14(5)13(4)19-11-9-10-17-7/h8,17,19H,2,4,9-11H2,1,3,5-7H3/b16-15+,18-8+,20-14+ |
| InChIKey | YAVSQKPEDKQIGX-XRIQTKRBSA-N |
| XLogP | 3.06 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|