About N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine
N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine (PubChem CID 166944361) has the molecular formula C15H22N4S
and a molecular weight of 290.44 g/mol. Its IUPAC name is N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine.
Molecular Properties
| Compound Name | N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine |
| PubChem CID | 166944361 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine |
| SMILES | C=C(NC(CCC)CCC)c1nc2c(C)ncnc2s1 |
| InChI | InChI=1S/C15H22N4S/c1-5-7-12(8-6-2)18-11(4)14-19-13-10(3)16-9-17-15(13)20-14/h9,12,18H,4-8H2,1-3H3 |
| InChIKey | KNUDFSHAZLXCCR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine?
The IUPAC name of N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine (CID 166944361) is N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine.
What is the SMILES notation for N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine?
The canonical SMILES for N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine is C=C(NC(CCC)CCC)c1nc2c(C)ncnc2s1.
What is the InChIKey of N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine?
The InChIKey is KNUDFSHAZLXCCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4S/c1-5-7-12(8-6-2)18-11(4)14-19-13-10(3)16-9-17-15(13)20-14/h9,12,18H,4-8H2,1-3H3.
What are the key properties of N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine?
N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine has a molecular weight of 290.44 g/mol, XLogP of 3.92, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(7-methyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)ethenyl]heptan-4-amine is sourced from PubChem (CID 166944361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).