About azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine
azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine (PubChem CID 166944543) has the molecular formula C8H11F3N2S
and a molecular weight of 224.25 g/mol. Its IUPAC name is azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine.
Molecular Properties
| Compound Name | azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine |
| PubChem CID | 166944543 |
| Molecular Formula | C8H11F3N2S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine |
| SMILES | N.NSC1=CC=C(C(F)(F)F)C=CC1 |
| InChI | InChI=1S/C8H8F3NS.H3N/c9-8(10,11)6-2-1-3-7(13-12)5-4-6;/h1-2,4-5H,3,12H2;1H3 |
| InChIKey | NUPPRPVJYYKMBV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine?
The IUPAC name of azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine (CID 166944543) is azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine.
What is the SMILES notation for azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine?
The canonical SMILES for azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine is N.NSC1=CC=C(C(F)(F)F)C=CC1.
What is the InChIKey of azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine?
The InChIKey is NUPPRPVJYYKMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NS.H3N/c9-8(10,11)6-2-1-3-7(13-12)5-4-6;/h1-2,4-5H,3,12H2;1H3.
What are the key properties of azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine?
azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine has a molecular weight of 224.25 g/mol, XLogP of 3.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;S-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]thiohydroxylamine is sourced from PubChem (CID 166944543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).