C15H22FN — CID 166944800
3,4-diethyl-1-[(2-fluorophenyl)methyl]pyrrolidine (PubChem CID 166944800) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is 3,4-diethyl-1-[(2-fluorophenyl)methyl]pyrrolidine.
| Compound Name | 3,4-diethyl-1-[(2-fluorophenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 166944800 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 3,4-diethyl-1-[(2-fluorophenyl)methyl]pyrrolidine |
| SMILES | CCC1CN(Cc2ccccc2F)CC1CC |
| InChI | InChI=1S/C15H22FN/c1-3-12-9-17(10-13(12)4-2)11-14-7-5-6-8-15(14)16/h5-8,12-13H,3-4,9-11H2,1-2H3 |
| InChIKey | VEDVUZQRYHTZER-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |