C23H24FN3O — CID 166944824
N-[(3E,5E)-3-amino-6-(4-fluorophenyl)hepta-1,3,5-trien-2-yl]-5-methyl-1,3-dihydroisoindole-2-carboxamide (PubChem CID 166944824) has the molecular formula C23H24FN3O and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[(3E,5E)-3-amino-6-(4-fluorophenyl)hepta-1,3,5-trien-2-yl]-5-methyl-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | N-[(3E,5E)-3-amino-6-(4-fluorophenyl)hepta-1,3,5-trien-2-yl]-5-methyl-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 166944824 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[(3E,5E)-3-amino-6-(4-fluorophenyl)hepta-1,3,5-trien-2-yl]-5-methyl-1,3-dihydroisoindole-2-carboxamide |
| SMILES | C=C(NC(=O)N1Cc2ccc(C)cc2C1)/C(N)=C\C=C(/C)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H24FN3O/c1-15-4-6-19-13-27(14-20(19)12-15)23(28)26-17(3)22(25)11-5-16(2)18-7-9-21(24)10-8-18/h4-12H,3,13-14,25H2,1-2H3,(H,26,28)/b16-5+,22-11+ |
| InChIKey | OOFCYCYDBGIIJW-AGBSYYRGSA-N |
| XLogP | 4.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|