About (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate
(2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate (PubChem CID 166945533) has the molecular formula C5H4INO4
and a molecular weight of 268.99 g/mol. Its IUPAC name is (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate.
Molecular Properties
| Compound Name | (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate |
| PubChem CID | 166945533 |
| Molecular Formula | C5H4INO4 |
| Molecular Weight | 268.99 g/mol |
| Exact Mass | 268.92 |
| IUPAC Name | (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate |
| SMILES | O=C(I)ON1C(=O)C=CC1O |
| InChI | InChI=1S/C5H4INO4/c6-5(10)11-7-3(8)1-2-4(7)9/h1-3,8H |
| InChIKey | HTHYJVBIRIETKN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.99 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate?
The IUPAC name of (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate (CID 166945533) is (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate.
What is the SMILES notation for (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate?
The canonical SMILES for (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate is O=C(I)ON1C(=O)C=CC1O.
What is the InChIKey of (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate?
The InChIKey is HTHYJVBIRIETKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4INO4/c6-5(10)11-7-3(8)1-2-4(7)9/h1-3,8H.
What are the key properties of (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate?
(2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate has a molecular weight of 268.99 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-5-oxo-2H-pyrrol-1-yl) carboniodidate is sourced from PubChem (CID 166945533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).