About 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one
6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one (PubChem CID 166945788) has the molecular formula C16H17F3N2O3
and a molecular weight of 342.32 g/mol. Its IUPAC name is 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one.
Molecular Properties
| Compound Name | 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one |
| PubChem CID | 166945788 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one |
| SMILES | CC1(C)CC2(C=C(N)C1=O)CN(C(=O)c1ccc(C(F)(F)F)o1)C2 |
| InChI | InChI=1S/C16H17F3N2O3/c1-14(2)6-15(5-9(20)12(14)22)7-21(8-15)13(23)10-3-4-11(24-10)16(17,18)19/h3-5H,6-8,20H2,1-2H3 |
| InChIKey | BZWGOFNPVLVQKY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one?
The IUPAC name of 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one (CID 166945788) is 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one.
What is the SMILES notation for 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one?
The canonical SMILES for 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one is CC1(C)CC2(C=C(N)C1=O)CN(C(=O)c1ccc(C(F)(F)F)o1)C2.
What is the InChIKey of 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one?
The InChIKey is BZWGOFNPVLVQKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3N2O3/c1-14(2)6-15(5-9(20)12(14)22)7-21(8-15)13(23)10-3-4-11(24-10)16(17,18)19/h3-5H,6-8,20H2,1-2H3.
What are the key properties of 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one?
6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one has a molecular weight of 342.32 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-8,8-dimethyl-2-[5-(trifluoromethyl)furan-2-carbonyl]-2-azaspiro[3.5]non-5-en-7-one is sourced from PubChem (CID 166945788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).