C12H18N2S — CID 166946260
(3R)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine-1-carbothioamide (PubChem CID 166946260) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is (3R)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine-1-carbothioamide.
| Compound Name | (3R)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 166946260 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (3R)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine-1-carbothioamide |
| SMILES | C=C(/C=C\C=C/C)[C@H]1CCN(C(N)=S)C1 |
| InChI | InChI=1S/C12H18N2S/c1-3-4-5-6-10(2)11-7-8-14(9-11)12(13)15/h3-6,11H,2,7-9H2,1H3,(H2,13,15)/b4-3-,6-5-/t11-/m0/s1 |
| InChIKey | PKEHZYKZIMLIFB-JTKKVQRISA-N |
| XLogP | 2.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|