C31H42O8 — CID 166946279
[(3aR,7S,8R,9R,10R,10aS)-8-acetyloxy-3a,10a-dihydroxy-5-(hydroxymethyl)-2,7,8,10-tetramethyl-3-oxo-4,6a,7,9,10,10b-hexahydrobenzo[e]azulen-9-yl] (2E,4E,6E)-deca-2,4,6-trienoate (PubChem CID 166946279) has the molecular formula C31H42O8 and a molecular weight of 542.67 g/mol. Its IUPAC name is [(3aR,7S,8R,9R,10R,10aS)-8-acetyloxy-3a,10a-dihydroxy-5-(hydroxymethyl)-2,7,8,10-tetramethyl-3-oxo-4,6a,7,9,10,10b-hexahydrobenzo[e]azulen-9-yl] (2E,4E,6E)-deca-2,4,6-trienoate.
| Compound Name | [(3aR,7S,8R,9R,10R,10aS)-8-acetyloxy-3a,10a-dihydroxy-5-(hydroxymethyl)-2,7,8,10-tetramethyl-3-oxo-4,6a,7,9,10,10b-hexahydrobenzo[e]azulen-9-yl] (2E,4E,6E)-deca-2,4,6-trienoate |
|---|---|
| PubChem CID | 166946279 |
| Molecular Formula | C31H42O8 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | [(3aR,7S,8R,9R,10R,10aS)-8-acetyloxy-3a,10a-dihydroxy-5-(hydroxymethyl)-2,7,8,10-tetramethyl-3-oxo-4,6a,7,9,10,10b-hexahydrobenzo[e]azulen-9-yl] (2E,4E,6E)-deca-2,4,6-trienoate |
| SMILES | CCC/C=C/C=C/C=C/C(=O)O[C@@H]1[C@@H](C)[C@@]2(O)C(C=C(CO)C[C@]3(O)C(=O)C(C)=CC23)[C@H](C)[C@@]1(C)OC(C)=O |
| InChI | InChI=1S/C31H42O8/c1-7-8-9-10-11-12-13-14-26(34)38-28-21(4)31(37)24(20(3)29(28,6)39-22(5)33)16-23(18-32)17-30(36)25(31)15-19(2)27(30)35/h9-16,20-21,24-25,28,32,36-37H,7-8,17-18H2,1-6H3/b10-9+,12-11+,14-13+/t20-,21+,24?,25?,28+,29+,30+,31+/m0/s1 |
| InChIKey | AWBMRFMRPLXBLE-ZFZSOUPOSA-N |
| XLogP | 3.52 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|