About 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate
6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate (PubChem CID 166946428) has the molecular formula C14H19FN2O4
and a molecular weight of 298.31 g/mol. Its IUPAC name is 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate |
| PubChem CID | 166946428 |
| Molecular Formula | C14H19FN2O4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H19FN2O4/c1-10(2)13(19)21-8-6-4-3-5-7-17-9-11(15)12(18)16-14(17)20/h9H,1,3-8H2,2H3,(H,16,18,20) |
| InChIKey | HGBNXJBTVPZTNV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate?
The IUPAC name of 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate (CID 166946428) is 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate.
What is the SMILES notation for 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate?
The canonical SMILES for 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCCCCCn1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate?
The InChIKey is HGBNXJBTVPZTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2O4/c1-10(2)13(19)21-8-6-4-3-5-7-17-9-11(15)12(18)16-14(17)20/h9H,1,3-8H2,2H3,(H,16,18,20).
What are the key properties of 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate?
6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate has a molecular weight of 298.31 g/mol, XLogP of 1.36, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-fluoro-2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate is sourced from PubChem (CID 166946428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).