C35H38ClFN8O4S — CID 166947363
N-[2-[[5-chloro-2-[4-[4-[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]ethyl]piperazin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]amino]phenyl]-N-methylmethanesulfonamide (PubChem CID 166947363) has the molecular formula C35H38ClFN8O4S and a molecular weight of 721.26 g/mol. Its IUPAC name is N-[2-[[5-chloro-2-[4-[4-[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]ethyl]piperazin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]amino]phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-[[5-chloro-2-[4-[4-[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]ethyl]piperazin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]amino]phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 166947363 |
| Molecular Formula | C35H38ClFN8O4S |
| Molecular Weight | 721.26 g/mol |
| Exact Mass | 720.24 |
| IUPAC Name | N-[2-[[5-chloro-2-[4-[4-[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]ethyl]piperazin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]amino]phenyl]-N-methylmethanesulfonamide |
| SMILES | CN(c1ccccc1Nc1nc(Nc2ccc(N3CCN(CCc4ccc(C5CCC(=O)NC5=O)cc4)CC3)c(F)c2)ncc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C35H38ClFN8O4S/c1-43(50(2,48)49)31-6-4-3-5-29(31)40-33-27(36)22-38-35(42-33)39-25-11-13-30(28(37)21-25)45-19-17-44(18-20-45)16-15-23-7-9-24(10-8-23)26-12-14-32(46)41-34(26)47/h3-11,13,21-22,26H,12,14-20H2,1-2H3,(H,41,46,47)(H2,38,39,40,42) |
| InChIKey | IUMDCKANFJGHOB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.26 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|