C37H45ClN10O3 — CID 166947599
3-[4-[2-[2-[[1-[4-[[4-(2-aminoanilino)-5-chloropyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]amino]ethylamino]ethyl]anilino]piperidine-2,6-dione (PubChem CID 166947599) has the molecular formula C37H45ClN10O3 and a molecular weight of 713.29 g/mol. Its IUPAC name is 3-[4-[2-[2-[[1-[4-[[4-(2-aminoanilino)-5-chloropyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]amino]ethylamino]ethyl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[2-[2-[[1-[4-[[4-(2-aminoanilino)-5-chloropyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]amino]ethylamino]ethyl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166947599 |
| Molecular Formula | C37H45ClN10O3 |
| Molecular Weight | 713.29 g/mol |
| Exact Mass | 712.34 |
| IUPAC Name | 3-[4-[2-[2-[[1-[4-[[4-(2-aminoanilino)-5-chloropyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]amino]ethylamino]ethyl]anilino]piperidine-2,6-dione |
| SMILES | COc1cc(N2CCC(NCCNCCc3ccc(NC4CCC(=O)NC4=O)cc3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2N)n1 |
| InChI | InChI=1S/C37H45ClN10O3/c1-51-33-22-27(10-11-31(33)45-37-42-23-28(38)35(47-37)44-30-5-3-2-4-29(30)39)48-20-15-25(16-21-48)41-19-18-40-17-14-24-6-8-26(9-7-24)43-32-12-13-34(49)46-36(32)50/h2-11,22-23,25,32,40-41,43H,12-21,39H2,1H3,(H,46,49,50)(H2,42,44,45,47) |
| InChIKey | ZUDHTIWBXYHPJW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 170.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.29 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|