C17H19N3O3 — CID 166947626
3-(3-oxo-6-pyrrolidin-1-yl-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 166947626) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-(3-oxo-6-pyrrolidin-1-yl-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-oxo-6-pyrrolidin-1-yl-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 166947626 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3-(3-oxo-6-pyrrolidin-1-yl-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C17H19N3O3/c21-15-6-5-14(16(22)18-15)20-10-11-9-12(19-7-1-2-8-19)3-4-13(11)17(20)23/h3-4,9,14H,1-2,5-8,10H2,(H,18,21,22) |
| InChIKey | TYPLENQONTVIFY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|