About 2,4-diazatricyclo[6.4.1.04,13]tridecane
2,4-diazatricyclo[6.4.1.04,13]tridecane (PubChem CID 166949763) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 2,4-diazatricyclo[6.4.1.04,13]tridecane.
Molecular Properties
| Compound Name | 2,4-diazatricyclo[6.4.1.04,13]tridecane |
| PubChem CID | 166949763 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2,4-diazatricyclo[6.4.1.04,13]tridecane |
| SMILES | C1CCC2NCN3CCCC(C1)C23 |
| InChI | InChI=1S/C11H20N2/c1-2-6-10-11-9(4-1)5-3-7-13(11)8-12-10/h9-12H,1-8H2 |
| InChIKey | XKROHNNEHMMOHV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-diazatricyclo[6.4.1.04,13]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diazatricyclo[6.4.1.04,13]tridecane?
The IUPAC name of 2,4-diazatricyclo[6.4.1.04,13]tridecane (CID 166949763) is 2,4-diazatricyclo[6.4.1.04,13]tridecane.
What is the SMILES notation for 2,4-diazatricyclo[6.4.1.04,13]tridecane?
The canonical SMILES for 2,4-diazatricyclo[6.4.1.04,13]tridecane is C1CCC2NCN3CCCC(C1)C23.
What is the InChIKey of 2,4-diazatricyclo[6.4.1.04,13]tridecane?
The InChIKey is XKROHNNEHMMOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-2-6-10-11-9(4-1)5-3-7-13(11)8-12-10/h9-12H,1-8H2.
What are the key properties of 2,4-diazatricyclo[6.4.1.04,13]tridecane?
2,4-diazatricyclo[6.4.1.04,13]tridecane has a molecular weight of 180.29 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diazatricyclo[6.4.1.04,13]tridecane is sourced from PubChem (CID 166949763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).