C22H25N7O — CID 166950468
3-[3-[[7-(4-aminophenyl)pyrrolo[2,3-d]pyrimidin-4-yl]-methylamino]-4-methylpiperidin-1-yl]-3-oxopropanenitrile (PubChem CID 166950468) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is 3-[3-[[7-(4-aminophenyl)pyrrolo[2,3-d]pyrimidin-4-yl]-methylamino]-4-methylpiperidin-1-yl]-3-oxopropanenitrile.
| Compound Name | 3-[3-[[7-(4-aminophenyl)pyrrolo[2,3-d]pyrimidin-4-yl]-methylamino]-4-methylpiperidin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 166950468 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 3-[3-[[7-(4-aminophenyl)pyrrolo[2,3-d]pyrimidin-4-yl]-methylamino]-4-methylpiperidin-1-yl]-3-oxopropanenitrile |
| SMILES | CC1CCN(C(=O)CC#N)CC1N(C)c1ncnc2c1ccn2-c1ccc(N)cc1 |
| InChI | InChI=1S/C22H25N7O/c1-15-8-11-28(20(30)7-10-23)13-19(15)27(2)21-18-9-12-29(22(18)26-14-25-21)17-5-3-16(24)4-6-17/h3-6,9,12,14-15,19H,7-8,11,13,24H2,1-2H3 |
| InChIKey | FKEBVSUNWJSSGZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|