C15H30N2O2S — CID 166950968
(2R,9R)-2,9-diamino-4,7,10-trimethyl-8-oxododecanethioic S-acid (PubChem CID 166950968) has the molecular formula C15H30N2O2S and a molecular weight of 302.48 g/mol. Its IUPAC name is (2R,9R)-2,9-diamino-4,7,10-trimethyl-8-oxododecanethioic S-acid.
| Compound Name | (2R,9R)-2,9-diamino-4,7,10-trimethyl-8-oxododecanethioic S-acid |
|---|---|
| PubChem CID | 166950968 |
| Molecular Formula | C15H30N2O2S |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2R,9R)-2,9-diamino-4,7,10-trimethyl-8-oxododecanethioic S-acid |
| SMILES | CCC(C)[C@@H](N)C(=O)C(C)CCC(C)C[C@@H](N)C(=O)S |
| InChI | InChI=1S/C15H30N2O2S/c1-5-10(3)13(17)14(18)11(4)7-6-9(2)8-12(16)15(19)20/h9-13H,5-8,16-17H2,1-4H3,(H,19,20)/t9?,10?,11?,12-,13-/m1/s1 |
| InChIKey | CQKIHDFUUXBECI-FRRVBIHZSA-N |
| XLogP | 2.16 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|