About (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid
(2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid (PubChem CID 166951354) has the molecular formula C11H11FN2O4S2
and a molecular weight of 318.35 g/mol. Its IUPAC name is (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid |
| PubChem CID | 166951354 |
| Molecular Formula | C11H11FN2O4S2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid |
| SMILES | N[C@@H](CC(F)S(=O)(=O)c1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C11H11FN2O4S2/c12-9(5-6(13)10(15)16)20(17,18)11-14-7-3-1-2-4-8(7)19-11/h1-4,6,9H,5,13H2,(H,15,16)/t6-,9?/m0/s1 |
| InChIKey | HHRPOFIDUZZBQJ-AADKRJSRSA-N |
| XLogP | 1.17 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid?
The IUPAC name of (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid (CID 166951354) is (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid.
What is the SMILES notation for (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid?
The canonical SMILES for (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid is N[C@@H](CC(F)S(=O)(=O)c1nc2ccccc2s1)C(=O)O.
What is the InChIKey of (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid?
The InChIKey is HHRPOFIDUZZBQJ-AADKRJSRSA-N. The full InChI is InChI=1S/C11H11FN2O4S2/c12-9(5-6(13)10(15)16)20(17,18)11-14-7-3-1-2-4-8(7)19-11/h1-4,6,9H,5,13H2,(H,15,16)/t6-,9?/m0/s1.
What are the key properties of (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid?
(2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid has a molecular weight of 318.35 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-(1,3-benzothiazol-2-ylsulfonyl)-4-fluorobutanoic acid is sourced from PubChem (CID 166951354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).