C12H11ClN2O2 — CID 166951497
5-[2-(4-chlorophenyl)ethyl]-1,4-dihydropyrazine-2,3-dione (PubChem CID 166951497) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)ethyl]-1,4-dihydropyrazine-2,3-dione.
| Compound Name | 5-[2-(4-chlorophenyl)ethyl]-1,4-dihydropyrazine-2,3-dione |
|---|---|
| PubChem CID | 166951497 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 5-[2-(4-chlorophenyl)ethyl]-1,4-dihydropyrazine-2,3-dione |
| SMILES | O=c1[nH]cc(CCc2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C12H11ClN2O2/c13-9-4-1-8(2-5-9)3-6-10-7-14-11(16)12(17)15-10/h1-2,4-5,7H,3,6H2,(H,14,16)(H,15,17) |
| InChIKey | GMLFAOLEDKNTQI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|