C13H10FN3O2 — CID 166951516
4-[2-(5,6-dioxo-1,4-dihydropyrazin-2-yl)ethyl]-2-fluorobenzonitrile (PubChem CID 166951516) has the molecular formula C13H10FN3O2 and a molecular weight of 259.24 g/mol. Its IUPAC name is 4-[2-(5,6-dioxo-1,4-dihydropyrazin-2-yl)ethyl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-(5,6-dioxo-1,4-dihydropyrazin-2-yl)ethyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 166951516 |
| Molecular Formula | C13H10FN3O2 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-[2-(5,6-dioxo-1,4-dihydropyrazin-2-yl)ethyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1ccc(CCc2c[nH]c(=O)c(=O)[nH]2)cc1F |
| InChI | InChI=1S/C13H10FN3O2/c14-11-5-8(1-3-9(11)6-15)2-4-10-7-16-12(18)13(19)17-10/h1,3,5,7H,2,4H2,(H,16,18)(H,17,19) |
| InChIKey | WZPAVNDRAIXCEX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|