C12H12N2O4S2 — CID 166951728
5-[(4-methylsulfonylphenyl)sulfanylmethyl]-1,4-dihydropyrazine-2,3-dione (PubChem CID 166951728) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 5-[(4-methylsulfonylphenyl)sulfanylmethyl]-1,4-dihydropyrazine-2,3-dione.
| Compound Name | 5-[(4-methylsulfonylphenyl)sulfanylmethyl]-1,4-dihydropyrazine-2,3-dione |
|---|---|
| PubChem CID | 166951728 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 5-[(4-methylsulfonylphenyl)sulfanylmethyl]-1,4-dihydropyrazine-2,3-dione |
| SMILES | CS(=O)(=O)c1ccc(SCc2c[nH]c(=O)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C12H12N2O4S2/c1-20(17,18)10-4-2-9(3-5-10)19-7-8-6-13-11(15)12(16)14-8/h2-6H,7H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | DNHPSTANIRLJAO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|