C15H13FN4O3 — CID 166951803
5-[2-[3-fluoro-4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione (PubChem CID 166951803) has the molecular formula C15H13FN4O3 and a molecular weight of 316.29 g/mol. Its IUPAC name is 5-[2-[3-fluoro-4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione.
| Compound Name | 5-[2-[3-fluoro-4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione |
|---|---|
| PubChem CID | 166951803 |
| Molecular Formula | C15H13FN4O3 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 5-[2-[3-fluoro-4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione |
| SMILES | O=c1cc(-c2ccc(CCc3c[nH]c(=O)c(=O)[nH]3)cc2F)[nH][nH]1 |
| InChI | InChI=1S/C15H13FN4O3/c16-11-5-8(1-3-9-7-17-14(22)15(23)18-9)2-4-10(11)12-6-13(21)20-19-12/h2,4-7H,1,3H2,(H,17,22)(H,18,23)(H2,19,20,21) |
| InChIKey | QELVHZRUTQGPGD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|