C15H16ClN3O3 — CID 166951983
5-(7-chloro-3-ethyl-4-methyl-2H-1,4-benzoxazin-3-yl)-1,4-dihydropyrazine-2,3-dione (PubChem CID 166951983) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is 5-(7-chloro-3-ethyl-4-methyl-2H-1,4-benzoxazin-3-yl)-1,4-dihydropyrazine-2,3-dione.
| Compound Name | 5-(7-chloro-3-ethyl-4-methyl-2H-1,4-benzoxazin-3-yl)-1,4-dihydropyrazine-2,3-dione |
|---|---|
| PubChem CID | 166951983 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 5-(7-chloro-3-ethyl-4-methyl-2H-1,4-benzoxazin-3-yl)-1,4-dihydropyrazine-2,3-dione |
| SMILES | CCC1(c2c[nH]c(=O)c(=O)[nH]2)COc2cc(Cl)ccc2N1C |
| InChI | InChI=1S/C15H16ClN3O3/c1-3-15(12-7-17-13(20)14(21)18-12)8-22-11-6-9(16)4-5-10(11)19(15)2/h4-7H,3,8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | MVUVOMMIYAUXGI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|