C14H13F3N2O2 — CID 166952008
5-methyl-6-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione (PubChem CID 166952008) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is 5-methyl-6-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione.
| Compound Name | 5-methyl-6-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione |
|---|---|
| PubChem CID | 166952008 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-methyl-6-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione |
| SMILES | Cc1[nH]c(=O)c(=O)[nH]c1CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3N2O2/c1-8-11(19-13(21)12(20)18-8)7-4-9-2-5-10(6-3-9)14(15,16)17/h2-3,5-6H,4,7H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | QBMHQLBRRKHPNF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|