C55H36N4 — CID 166953373
23-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-phenyl-23-azapentacyclo[14.7.0.02,7.010,15.017,22]tricosa-1(16),2,4,6,8,10,12,14,17,19,21-undecaene (PubChem CID 166953373) has the molecular formula C55H36N4 and a molecular weight of 752.92 g/mol. Its IUPAC name is 23-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-phenyl-23-azapentacyclo[14.7.0.02,7.010,15.017,22]tricosa-1(16),2,4,6,8,10,12,14,17,19,21-undecaene.
| Compound Name | 23-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-phenyl-23-azapentacyclo[14.7.0.02,7.010,15.017,22]tricosa-1(16),2,4,6,8,10,12,14,17,19,21-undecaene |
|---|---|
| PubChem CID | 166953373 |
| Molecular Formula | C55H36N4 |
| Molecular Weight | 752.92 g/mol |
| Exact Mass | 752.29 |
| IUPAC Name | 23-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-phenyl-23-azapentacyclo[14.7.0.02,7.010,15.017,22]tricosa-1(16),2,4,6,8,10,12,14,17,19,21-undecaene |
| SMILES | C1=C(c2ccccc2)c2ccccc2-c2c(n(-c3cccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)c3ccccc23)-c2ccccc21 |
| InChI | InChI=1S/C55H36N4/c1-4-18-37(19-5-1)49-36-42-24-10-11-29-45(42)52-51(47-31-13-12-30-46(47)49)48-32-14-15-33-50(48)59(52)44-28-17-26-41(35-44)40-25-16-27-43(34-40)55-57-53(38-20-6-2-7-21-38)56-54(58-55)39-22-8-3-9-23-39/h1-36H/b42-36?,49-36?,49-46?,51-47-,52-45+ |
| InChIKey | DWMWQTZOAQJBMM-FVXDAFMRSA-N |
| XLogP | 13.72 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.92 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|