C9H9FO2 — CID 166953522
6-fluoro-2,3,4a,8a-tetrahydrochromen-4-one (PubChem CID 166953522) has the molecular formula C9H9FO2 and a molecular weight of 168.17 g/mol. Its IUPAC name is 6-fluoro-2,3,4a,8a-tetrahydrochromen-4-one.
| Compound Name | 6-fluoro-2,3,4a,8a-tetrahydrochromen-4-one |
|---|---|
| PubChem CID | 166953522 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 6-fluoro-2,3,4a,8a-tetrahydrochromen-4-one |
| SMILES | O=C1CCOC2C=CC(F)=CC12 |
| InChI | InChI=1S/C9H9FO2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5,7,9H,3-4H2 |
| InChIKey | CVNAEBGHYHIVKU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |