C15H26O6 — CID 166953541
(5S,7R,8S)-2-ethyl-8-(2-hydroxybutan-2-yloxy)-2,7-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one (PubChem CID 166953541) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is (5S,7R,8S)-2-ethyl-8-(2-hydroxybutan-2-yloxy)-2,7-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one.
| Compound Name | (5S,7R,8S)-2-ethyl-8-(2-hydroxybutan-2-yloxy)-2,7-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 166953541 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (5S,7R,8S)-2-ethyl-8-(2-hydroxybutan-2-yloxy)-2,7-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one |
| SMILES | CCC(C)(O)O[C@@H]1CO[C@]2(COC(C)(CC)O2)C(=O)[C@@H]1C |
| InChI | InChI=1S/C15H26O6/c1-6-13(4,17)20-11-8-18-15(12(16)10(11)3)9-19-14(5,7-2)21-15/h10-11,17H,6-9H2,1-5H3/t10-,11-,13?,14?,15+/m1/s1 |
| InChIKey | SRWNWABOPWOQEU-JOGVDJPQSA-N |
| XLogP | 1.59 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|