C16H14O2 — CID 166953593
(6aR,11bR)-7,11b-dihydro-6H-indeno[2,1-c]chromen-6a-ol (PubChem CID 166953593) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is (6aR,11bR)-7,11b-dihydro-6H-indeno[2,1-c]chromen-6a-ol.
| Compound Name | (6aR,11bR)-7,11b-dihydro-6H-indeno[2,1-c]chromen-6a-ol |
|---|---|
| PubChem CID | 166953593 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (6aR,11bR)-7,11b-dihydro-6H-indeno[2,1-c]chromen-6a-ol |
| SMILES | O[C@@]12COc3ccccc3[C@H]1c1ccccc1C2 |
| InChI | InChI=1S/C16H14O2/c17-16-9-11-5-1-2-6-12(11)15(16)13-7-3-4-8-14(13)18-10-16/h1-8,15,17H,9-10H2/t15-,16+/m1/s1 |
| InChIKey | LMKDYBABKPJWCB-CVEARBPZSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |