C14H28O2 — CID 166954190
4-ethoxy-3,3,4-trimethyl-2-(propan-2-yloxymethyl)pent-1-ene (PubChem CID 166954190) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 4-ethoxy-3,3,4-trimethyl-2-(propan-2-yloxymethyl)pent-1-ene.
| Compound Name | 4-ethoxy-3,3,4-trimethyl-2-(propan-2-yloxymethyl)pent-1-ene |
|---|---|
| PubChem CID | 166954190 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 4-ethoxy-3,3,4-trimethyl-2-(propan-2-yloxymethyl)pent-1-ene |
| SMILES | C=C(COC(C)C)C(C)(C)C(C)(C)OCC |
| InChI | InChI=1S/C14H28O2/c1-9-16-14(7,8)13(5,6)12(4)10-15-11(2)3/h11H,4,9-10H2,1-3,5-8H3 |
| InChIKey | BCBFZWKKAGTLTG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|