C23H29N5S — CID 166954545
(Z)-4-methyl-3-[[6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]-4-pyrrolidin-1-ylpent-2-ene-1-thiol (PubChem CID 166954545) has the molecular formula C23H29N5S and a molecular weight of 407.59 g/mol. Its IUPAC name is (Z)-4-methyl-3-[[6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]-4-pyrrolidin-1-ylpent-2-ene-1-thiol.
| Compound Name | (Z)-4-methyl-3-[[6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]-4-pyrrolidin-1-ylpent-2-ene-1-thiol |
|---|---|
| PubChem CID | 166954545 |
| Molecular Formula | C23H29N5S |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (Z)-4-methyl-3-[[6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]-4-pyrrolidin-1-ylpent-2-ene-1-thiol |
| SMILES | Cn1cc(-c2ccc3cnc(N/C(=C\CS)C(C)(C)N4CCCC4)cc3c2)cn1 |
| InChI | InChI=1S/C23H29N5S/c1-23(2,28-9-4-5-10-28)21(8-11-29)26-22-13-19-12-17(6-7-18(19)14-24-22)20-15-25-27(3)16-20/h6-8,12-16,29H,4-5,9-11H2,1-3H3,(H,24,26)/b21-8- |
| InChIKey | HAUKNQJZEDEZRU-WNFQYIGGSA-N |
| XLogP | 4.74 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|