C14H25NO — CID 166955265
(2Z,4Z,6Z)-5-[[tert-butyl(methyl)amino]methyl]octa-2,4,6-trien-4-ol (PubChem CID 166955265) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (2Z,4Z,6Z)-5-[[tert-butyl(methyl)amino]methyl]octa-2,4,6-trien-4-ol.
| Compound Name | (2Z,4Z,6Z)-5-[[tert-butyl(methyl)amino]methyl]octa-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 166955265 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2Z,4Z,6Z)-5-[[tert-butyl(methyl)amino]methyl]octa-2,4,6-trien-4-ol |
| SMILES | C/C=C\C(O)=C(/C=C\C)CN(C)C(C)(C)C |
| InChI | InChI=1S/C14H25NO/c1-7-9-12(13(16)10-8-2)11-15(6)14(3,4)5/h7-10,16H,11H2,1-6H3/b9-7-,10-8-,13-12- |
| InChIKey | IYWTVKQHWQZMAV-XKBLAIEVSA-N |
| XLogP | 3.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|