About 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane
1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane (PubChem CID 16695544) has the molecular formula C9H17GeNO3
and a molecular weight of 259.85 g/mol. Its IUPAC name is 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane.
Molecular Properties
| Compound Name | 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane |
| PubChem CID | 16695544 |
| Molecular Formula | C9H17GeNO3 |
| Molecular Weight | 259.85 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane |
| SMILES | C=CC[Ge]12OCCN(CCO1)CCO2 |
| InChI | InChI=1S/C9H17GeNO3/c1-2-3-10-12-7-4-11(5-8-13-10)6-9-14-10/h2H,1,3-9H2 |
| InChIKey | MPJMDNJEKQCSHD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.85 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane?
The IUPAC name of 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane (CID 16695544) is 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane.
What is the SMILES notation for 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane?
The canonical SMILES for 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane is C=CC[Ge]12OCCN(CCO1)CCO2.
What is the InChIKey of 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane?
The InChIKey is MPJMDNJEKQCSHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17GeNO3/c1-2-3-10-12-7-4-11(5-8-13-10)6-9-14-10/h2H,1,3-9H2.
What are the key properties of 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane?
1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane has a molecular weight of 259.85 g/mol, XLogP of 0.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane is sourced from PubChem (CID 16695544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).