About 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine
4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine (PubChem CID 166955539) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine.
Molecular Properties
| Compound Name | 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine |
| PubChem CID | 166955539 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine |
| SMILES | C=C(CCC1CNC1)N(CCC)CCC |
| InChI | InChI=1S/C13H26N2/c1-4-8-15(9-5-2)12(3)6-7-13-10-14-11-13/h13-14H,3-11H2,1-2H3 |
| InChIKey | GVEJYZMLNYARKP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine?
The IUPAC name of 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine (CID 166955539) is 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine.
What is the SMILES notation for 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine?
The canonical SMILES for 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine is C=C(CCC1CNC1)N(CCC)CCC.
What is the InChIKey of 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine?
The InChIKey is GVEJYZMLNYARKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-4-8-15(9-5-2)12(3)6-7-13-10-14-11-13/h13-14H,3-11H2,1-2H3.
What are the key properties of 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine?
4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine has a molecular weight of 210.36 g/mol, XLogP of 2.62, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-3-yl)-N,N-dipropylbut-1-en-2-amine is sourced from PubChem (CID 166955539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).