About 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide
4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 166955921) has the molecular formula C8H14F3NO2S
and a molecular weight of 245.27 g/mol. Its IUPAC name is 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide |
| PubChem CID | 166955921 |
| Molecular Formula | C8H14F3NO2S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CC(C)N1CCS(=O)(=O)C(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H14F3NO2S/c1-6(2)12-3-4-15(13,14)7(5-12)8(9,10)11/h6-7H,3-5H2,1-2H3 |
| InChIKey | KJSZLXILVMKNAQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide?
The IUPAC name of 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide (CID 166955921) is 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide is CC(C)N1CCS(=O)(=O)C(C(F)(F)F)C1.
What is the InChIKey of 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide?
The InChIKey is KJSZLXILVMKNAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2S/c1-6(2)12-3-4-15(13,14)7(5-12)8(9,10)11/h6-7H,3-5H2,1-2H3.
What are the key properties of 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide?
4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide has a molecular weight of 245.27 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-2-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 166955921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).