C18H35N3O — CID 166956046
4-(hexylamino)-N-[(3R)-pyrrolidin-3-yl]cycloheptane-1-carboxamide (PubChem CID 166956046) has the molecular formula C18H35N3O and a molecular weight of 309.50 g/mol. Its IUPAC name is 4-(hexylamino)-N-[(3R)-pyrrolidin-3-yl]cycloheptane-1-carboxamide.
| Compound Name | 4-(hexylamino)-N-[(3R)-pyrrolidin-3-yl]cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 166956046 |
| Molecular Formula | C18H35N3O |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.28 |
| IUPAC Name | 4-(hexylamino)-N-[(3R)-pyrrolidin-3-yl]cycloheptane-1-carboxamide |
| SMILES | CCCCCCNC1CCCC(C(=O)N[C@@H]2CCNC2)CC1 |
| InChI | InChI=1S/C18H35N3O/c1-2-3-4-5-12-20-16-8-6-7-15(9-10-16)18(22)21-17-11-13-19-14-17/h15-17,19-20H,2-14H2,1H3,(H,21,22)/t15?,16?,17-/m1/s1 |
| InChIKey | QNLQBWREPFJVBE-OFLPRAFFSA-N |
| XLogP | 2.58 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|