About 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine
6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine (PubChem CID 166956818) has the molecular formula C10H13IN4S
and a molecular weight of 348.21 g/mol. Its IUPAC name is 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine.
Molecular Properties
| Compound Name | 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine |
| PubChem CID | 166956818 |
| Molecular Formula | C10H13IN4S |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine |
| SMILES | CCn1cc(C2=NC(SC)=NCC2)c(I)n1 |
| InChI | InChI=1S/C10H13IN4S/c1-3-15-6-7(9(11)14-15)8-4-5-12-10(13-8)16-2/h6H,3-5H2,1-2H3 |
| InChIKey | XWWRLZIONAKGAI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine?
The IUPAC name of 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine (CID 166956818) is 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine.
What is the SMILES notation for 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine?
The canonical SMILES for 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine is CCn1cc(C2=NC(SC)=NCC2)c(I)n1.
What is the InChIKey of 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine?
The InChIKey is XWWRLZIONAKGAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13IN4S/c1-3-15-6-7(9(11)14-15)8-4-5-12-10(13-8)16-2/h6H,3-5H2,1-2H3.
What are the key properties of 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine?
6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine has a molecular weight of 348.21 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-ethyl-3-iodopyrazol-4-yl)-2-methylsulfanyl-4,5-dihydropyrimidine is sourced from PubChem (CID 166956818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).