About 9,9-dimethyl-5,6-didehydrofluoren-3-amine
9,9-dimethyl-5,6-didehydrofluoren-3-amine (PubChem CID 166956873) has the molecular formula C15H13N
and a molecular weight of 207.28 g/mol. Its IUPAC name is 9,9-dimethyl-5,6-didehydrofluoren-3-amine.
Molecular Properties
| Compound Name | 9,9-dimethyl-5,6-didehydrofluoren-3-amine |
| PubChem CID | 166956873 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 9,9-dimethyl-5,6-didehydrofluoren-3-amine |
| SMILES | CC1(C)c2ccc#cc2-c2cc(N)ccc21 |
| InChI | InChI=1S/C15H13N/c1-15(2)13-6-4-3-5-11(13)12-9-10(16)7-8-14(12)15/h4,6-9H,16H2,1-2H3 |
| InChIKey | UMGIYQBGOKDJGC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9,9-dimethyl-5,6-didehydrofluoren-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethyl-5,6-didehydrofluoren-3-amine?
The IUPAC name of 9,9-dimethyl-5,6-didehydrofluoren-3-amine (CID 166956873) is 9,9-dimethyl-5,6-didehydrofluoren-3-amine.
What is the SMILES notation for 9,9-dimethyl-5,6-didehydrofluoren-3-amine?
The canonical SMILES for 9,9-dimethyl-5,6-didehydrofluoren-3-amine is CC1(C)c2ccc#cc2-c2cc(N)ccc21.
What is the InChIKey of 9,9-dimethyl-5,6-didehydrofluoren-3-amine?
The InChIKey is UMGIYQBGOKDJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N/c1-15(2)13-6-4-3-5-11(13)12-9-10(16)7-8-14(12)15/h4,6-9H,16H2,1-2H3.
What are the key properties of 9,9-dimethyl-5,6-didehydrofluoren-3-amine?
9,9-dimethyl-5,6-didehydrofluoren-3-amine has a molecular weight of 207.28 g/mol, XLogP of 3.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethyl-5,6-didehydrofluoren-3-amine is sourced from PubChem (CID 166956873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).