About 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine
4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine (PubChem CID 166956954) has the molecular formula C21H19N
and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine.
Molecular Properties
| Compound Name | 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine |
| PubChem CID | 166956954 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine |
| SMILES | CC1CC=Cc2c1c(-c1ccccc1)c1ccccc1c2N |
| InChI | InChI=1S/C21H19N/c1-14-8-7-13-18-19(14)20(15-9-3-2-4-10-15)16-11-5-6-12-17(16)21(18)22/h2-7,9-14H,8,22H2,1H3 |
| InChIKey | WXQWFWODJYGDQP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine?
The IUPAC name of 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine (CID 166956954) is 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine.
What is the SMILES notation for 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine?
The canonical SMILES for 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine is CC1CC=Cc2c1c(-c1ccccc1)c1ccccc1c2N.
What is the InChIKey of 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine?
The InChIKey is WXQWFWODJYGDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N/c1-14-8-7-13-18-19(14)20(15-9-3-2-4-10-15)16-11-5-6-12-17(16)21(18)22/h2-7,9-14H,8,22H2,1H3.
What are the key properties of 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine?
4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine has a molecular weight of 285.39 g/mol, XLogP of 5.61, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-10-phenyl-3,4-dihydroanthracen-9-amine is sourced from PubChem (CID 166956954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).