C13H18F3N — CID 166957073
2-[(2Z,4E)-6,6,6-trifluoro-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]pyrrolidine (PubChem CID 166957073) has the molecular formula C13H18F3N and a molecular weight of 245.29 g/mol. Its IUPAC name is 2-[(2Z,4E)-6,6,6-trifluoro-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]pyrrolidine.
| Compound Name | 2-[(2Z,4E)-6,6,6-trifluoro-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 166957073 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-[(2Z,4E)-6,6,6-trifluoro-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]pyrrolidine |
| SMILES | C/C=C\C(=C/C=C/C(F)(F)F)CC1CCCN1 |
| InChI | InChI=1S/C13H18F3N/c1-2-5-11(6-3-8-13(14,15)16)10-12-7-4-9-17-12/h2-3,5-6,8,12,17H,4,7,9-10H2,1H3/b5-2-,8-3+,11-6+ |
| InChIKey | LYCFYVGKXPVWNR-RZMNYDGKSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|