C48H36N2OS — CID 166957212
N-dibenzothiophen-1-yl-9-[(3Z)-hexa-3,5-dienyl]-N-[(2Z,4Z)-6-methylidene-1-benzoxocin-7-yl]-7-phenylcarbazol-3-amine (PubChem CID 166957212) has the molecular formula C48H36N2OS and a molecular weight of 688.90 g/mol. Its IUPAC name is N-dibenzothiophen-1-yl-9-[(3Z)-hexa-3,5-dienyl]-N-[(2Z,4Z)-6-methylidene-1-benzoxocin-7-yl]-7-phenylcarbazol-3-amine.
| Compound Name | N-dibenzothiophen-1-yl-9-[(3Z)-hexa-3,5-dienyl]-N-[(2Z,4Z)-6-methylidene-1-benzoxocin-7-yl]-7-phenylcarbazol-3-amine |
|---|---|
| PubChem CID | 166957212 |
| Molecular Formula | C48H36N2OS |
| Molecular Weight | 688.90 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | N-dibenzothiophen-1-yl-9-[(3Z)-hexa-3,5-dienyl]-N-[(2Z,4Z)-6-methylidene-1-benzoxocin-7-yl]-7-phenylcarbazol-3-amine |
| SMILES | C=C/C=C\CCn1c2ccc(N(c3cccc4c3C(=C)/C=C\C=C/O4)c3cccc4sc5ccccc5c34)cc2c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C48H36N2OS/c1-3-4-5-12-29-49-40-28-26-36(32-39(40)37-27-25-35(31-43(37)49)34-17-7-6-8-18-34)50(41-20-14-22-44-47(41)33(2)16-11-13-30-51-44)42-21-15-24-46-48(42)38-19-9-10-23-45(38)52-46/h3-11,13-28,30-32H,1-2,12,29H2/b5-4-,16-11-,30-13- |
| InChIKey | BWNUDRZSSCFGTL-NLEYIEIOSA-N |
| XLogP | 13.91 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.90 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|