About N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine
N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine (PubChem CID 166958141) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine |
| PubChem CID | 166958141 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine |
| SMILES | C/C=C\c1nc(NC)[nH]c1/C=C\C |
| InChI | InChI=1S/C10H15N3/c1-4-6-8-9(7-5-2)13-10(11-3)12-8/h4-7H,1-3H3,(H2,11,12,13)/b6-4-,7-5- |
| InChIKey | JGMUUCPLAXWWII-PEPZGXQESA-N |
| XLogP | 2.52 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine?
The IUPAC name of N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine (CID 166958141) is N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine.
What is the SMILES notation for N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine?
The canonical SMILES for N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine is C/C=C\c1nc(NC)[nH]c1/C=C\C.
What is the InChIKey of N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine?
The InChIKey is JGMUUCPLAXWWII-PEPZGXQESA-N. The full InChI is InChI=1S/C10H15N3/c1-4-6-8-9(7-5-2)13-10(11-3)12-8/h4-7H,1-3H3,(H2,11,12,13)/b6-4-,7-5-.
What are the key properties of N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine?
N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine has a molecular weight of 177.25 g/mol, XLogP of 2.52, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4,5-bis[(Z)-prop-1-enyl]-1H-imidazol-2-amine is sourced from PubChem (CID 166958141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).